This compound is a chiral alcohol used as a research reagent. It features a stereocenter and contains an aromatic ring substituted with chlorine and fluorine atoms, contributing to its specific molecular properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 877397-65-4
Tert-butyl 4-(4-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate
Research compound for synthesis
Tetrabutylammonium fluoride trihydrate
Phase transfer catalyst and fluorination reagent
H2-Gamendazole
research compound
KG 5
research compound
(alphaR)-2,6-Dichloro-3-fluoro-alpha-methylbenzenemethanol
pharmaceutical intermediate
(1S)-1-(2,6-dichloro-3-fluorophenyl)ethanol
JAOYKRSASYNDGH-BYPYZUCNSA-N
C[C@@H](C1=C(C=CC(=C1Cl)F)Cl)O