4-Bromo-2-nitroaniline is a chemical compound used primarily as a dye intermediate. It features an amine group attached to an aromatic ring with bromine and nitro substituents, making it suitable for synthesizing various dyes and pigments.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 875-51-4
2,4,6-TRIMETHYLANILINE
Dye intermediate
2-Amino-3,5-dimethylbenzenesulfonic acid
Dye intermediate
3-Amino-5-chloro-2-hydroxybenzenesulfonic acid
Dye intermediate for azo dyes
5-Amino-2-chlorobenzenesulfonic Acid
Intermediate for pigment red 58
4-bromo-2-nitroaniline
ZCWBZRBJSPWUPG-UHFFFAOYSA-N
C1=CC(=C(C=C1Br)[N+](=O)[O-])N