m-PEG7-acid is a monodisperse polyethylene glycol (PEG) derivative containing a terminal carboxylic acid group. It is primarily used as a research reagent for PEGylation, a process that modifies biomolecules or surfaces to improve solubility and stability.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 874208-91-0
(2-Cyanopyridin-3-yl)boronic acid
research compound for boronic acid chemistry
3-p-Anisoyl Acacetin
Impurity reference standard for acacetin
(S)-benzyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
L-Phenylalanine, (alphaS)-alpha-[[2-(4-morpholinyl)acetyl]amino]benzenebutanoyl-L-leucyl-, phenylmethyl ester
research compound
3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
NOPQIPMESCUIHH-UHFFFAOYSA-N
COCCOCCOCCOCCOCCOCCOCCC(=O)O