Boc-Val-Cit-OH is a peptide compound featuring a tert-butoxycarbonyl (Boc) protecting group on the N-terminus and a citrulline residue. It is primarily used as a research compound in laboratory settings, particularly for peptide synthesis and biochemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 870487-08-4
Boc-Val-Cit-PABA
research compound for ADC
5-Chloro-3-iodo-2-methylaniline
research compound
4-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
synthetic building block for cross-coupling
2-AMINO-N,3-DIMETHYLBENZAMIDE
research compound for crystallography
(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoic acid
ZZLNUAVYYRBTOZ-QWRGUYRKSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)O)NC(=O)OC(C)(C)C