This compound is a protected amino acid derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a methoxy side chain. It is primarily used as an intermediate in the synthesis of peptides and other pharmaceutical compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 86123-95-7
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
(S)-2-Hydroxyethyl 2-amino-3-methylbutanoate 4-methylbenzenesulfonate
pharmaceutical intermediate for acyclovir impurities
Dienogest Impurity G
Pharmaceutical intermediate for dienogest
3-Fluoro-5-iodo-4-methylbenzoic acid
Pharmaceutical intermediate
1-(2,2-DIFLUOROBENZO[D][1,3]DIOXOL-5-YL)CYCLOPROPANECARBONITRILE
pharmaceutical intermediate
2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
Building block for peptide synthesis
(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
RFGMSGRWQUMJIR-ZCFIWIBFSA-N
CC(C)(C)OC(=O)N[C@H](COC)C(=O)O