6-Methoxy-8-nitroquinoline is a research reagent primarily used in laboratory settings. It is a quinoline derivative featuring a methoxy group and a nitro group, commonly employed in chemical synthesis and analytical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 85-81-4
(Cyclopent-1-en-1-yl)boronic acid
Boronic acid building block
Lithium iodide (LiI), trihydrate
Laboratory reagent
(2S)-3-(dimethylamino)-1-(3-methoxyphenyl)-2-methyl-1-propanone
Research compound
4-FLUORO-2-(TRIFLUOROMETHYL)PYRIDINE
fluorinated pyridine research compound
6-methoxy-8-nitroquinoline
MIMUSZHMZBJBPO-UHFFFAOYSA-N
COC1=CC(=C2C(=C1)C=CC=N2)[N+](=O)[O-]