2-(4-hydroxy-3-phenylbenzoyl)benzoic acid is a chemical compound with a molecular weight of approximately 318. 1 g/mol.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 84627-04-3
7-Hydroxy-1H-indole-2-carboxylic acid
pharmaceutical intermediate
1-{[(benzyloxy)carbonyl]amino}cyclopropane-1-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
5-Methyl-2'-o,4'-C-methylenecytidine
nucleoside analogue intermediate
(S)-tert-Butyl (1-(4-bromophenyl)ethyl)carbamate
Pharmaceutical intermediate for synthesis
2-(4-hydroxy-3-phenylbenzoyl)benzoic acid
PKHPZNKXOBWFCX-UHFFFAOYSA-N
C1=CC=C(C=C1)C2=C(C=CC(=C2)C(=O)C3=CC=CC=C3C(=O)O)O