(4-Cyano-3-fluorophenyl)boronic acid is a boronic acid building block used primarily in research and laboratory settings. It features an aromatic ring with a nitrile group and a halogen substituent, contributing to its utility in synthetic chemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 843663-18-3
3-Cyano-4-fluorophenylboronic acid
Pharmaceutical intermediate for synthesis
2,6-DICHLOROPYRIDINE-4-BORONIC ACID
boronic acid building block
3-Bromopyridin-4-ylboronic acid
boronic acid building block
1-(tert-butyl) 5-(2,5-dioxopyrrolidin-1-yl) (16-(tert-butoxy)-16-oxohexadecanoyl)-L-glutamate
research chemical intermediate
1-tert-Butyl 18-(2,5-dioxopyrrolidin-1-yl) octadecanedioate
research compound
1-Aminocyclopropane-2,2,3,3-d4-carboxylic acid
deuterated analytical reference standard
4-Nitro-2H-1,2,3-triazole
chemical synthesis intermediate
(4-cyano-3-fluorophenyl)boronic acid
DECWLXUOZUMPBF-UHFFFAOYSA-N
B(C1=CC(=C(C=C1)C#N)F)(O)O