This compound is a piperidine carboxylic acid derivative bearing a tert-butoxycarbonyl (Boc) protecting group on the nitrogen atom. It is commonly used as a pharmaceutical intermediate in the synthesis of more complex molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 84358-12-3
(3S)-1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
(3R)-1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
pharmaceutical intermediate for synthesis
Tert-butyl 3-acetylpiperidine-1-carboxylate
Pharmaceutical intermediate for synthesis
N-BOC-piperidine-4-carboxylic acid
Pharmaceutical intermediate
6,8-Difluoro-2-tetralone
Pharmaceutical intermediate
16-tert-Butoxy-16-oxohexadecanoate
pharmaceutical intermediate
(3R)-4-chloro-3-hydroxybutanenitrile
Pharmaceutical intermediate
1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid
NXILIHONWRXHFA-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCCC(C1)C(=O)O