Lithocholic acid-2,2,4,4-d4 is a deuterated form of lithocholic acid, used as a stable isotope labeled internal standard. It carries four deuterium atoms at specific positions in the steroid backbone, making it valuable for quantitative analysis in research settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 83701-16-0
Glycolithocholic acid-d4
Deuterated bile acid analytical standard
Deoxycholic-2,2,4,4-D4 acid
Deuterated analytical reference standard
Heptanoic-d13 acid
stable isotope labeled internal standard
1,4-Dichlorobenzene-d4
stable isotope labeled internal standard
4-METHYL-D3-CATECHOL
research compound
2-Daos
reagent for cholesterol determination
2-iodo-4,6-diphenyl-1,3,5-triazine
chemical research reagent
4-(4-Methylphenylthio)benzophenone
photoinitiator for polymerization
(4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-2,2,4,4-tetradeuterio-3-hydroxy-10,13-dimethyl-3,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
SMEROWZSTRWXGI-POXZWENPSA-N
[2H]C1(C[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC[C@@H]2C([C@@H]1O)([2H])[2H])CC[C@@H]4[C@H](C)CCC(=O)O)C)C)[2H]