1-Adamantanecarboxylic acid is a chemical compound used as an intermediate in the manufacturing of rimantadine hydrochloride. It features a carboxylic acid group attached to an adamantane cage structure.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 828-51-3
3-(1-(tert-Butoxycarbonyl)piperidin-4-yl)benzoic acid
Pharmaceutical intermediate for drug synthesis
(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid
Perindopril intermediate
N-(9-Fluorenylmethoxycarbonyloxy)succinimide
Fmoc-amino acid precursor
6-Hydroxy-2-naphthimidamide methanesulfonate salt
Pharmaceutical intermediate
adamantane-1-carboxylic acid
JIMXXGFJRDUSRO-UHFFFAOYSA-N
C1C2CC3CC1CC(C2)(C3)C(=O)O