5-Br-Paps is a sulfonic acid derivative used as a research reagent. Its structure features a brominated pyridyl azo group and a propylaminopropane sulfonic acid moiety, giving it a moderate molecular weight and polar surface area.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 81608-06-2
Tert-Butyl isonicotinate
research compound
2-Bromoethanol-1,1,2,2-d4
deuterated research reagent
Di-T-Butylphosphine
Organophosphine ligand for catalysis
Disodium glycerophosphate
organic sodium salt reagent
3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid
BZRWWAYVITZYRZ-UHFFFAOYSA-N
CCCN(CCCS(=O)(=O)O)C1=CC(=C(C=C1)N=NC2=NC=C(C=C2)Br)O