Crassicauline A is a diterpene alkaloid plant metabolite isolated from several Aconitum species. It is characterized as a toxic compound with a complex polycyclic structure, functioning as a xenobiotic and a human urinary metabolite.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 79592-91-9
2-chloro-6-(trifluoromethyl)pyridine-4-carboxylic Acid
research compound
2,5-Dibromo-3-(trifluoromethyl)pyridine
research compound
Urea, N-(2-chloro-4-hydroxyphenyl)-N'-cyclopropyl-
research compound
3-Chloro-2-fluoro-4-iodopyridine
research compound
[(1S,2R,3R,4R,5S,6S,8R,9R,13S,16S,17R,18R)-8-acetyloxy-11-ethyl-5-hydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] 4-methoxybenzoate
GAZDXIGXYWVWQX-QVAFJCLZSA-N
CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@H]([C@@H](C31)[C@]5(C[C@@H]([C@]6(C[C@@H]4[C@@H]5[C@H]6OC(=O)C7=CC=C(C=C7)OC)O)OC)OC(=O)C)OC)OC)COC