2-HYDROXY-5-NITROBENZYL BROMIDE is a chemical compound commonly used as a laboratory reagent. Its primary significance is in research applications for the chemical modification of tryptophan residues in proteins.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 772-33-8
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
3-Amino-3-(1-methyl-1H-pyrrol-2-yl)propanoic acid
research compound for peptide synthesis
1,3-Benzodioxole-5-carboxylic acid, 2,2-difluoro-, methyl ester
research compound
2-(bromomethyl)-4-nitrophenol
KFDPCYZHENQOBV-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])CBr)O