This compound is a protected amino acid derivative featuring a tert-butyloxycarbonyl (Boc) protecting group, a hydroxyl group, and a benzyl side chain. It serves as a pharmaceutical intermediate specifically designed for peptide synthesis in research and manufacturing settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 77171-41-6
Ethyl 5-bromopicolinate
pharmaceutical intermediate
TERT-BUTYL 4-PHENYLPIPERAZINE-1-CARBOXYLATE
Pharmaceutical intermediate
Tert-butyl 4-(2-hydroxyethyl)piperazine-1-carboxylate
pharmaceutical intermediate
Norlidocaine Hydrochloride
Lidocaine impurity study
3-tert-Butoxycarbonylamino-2-hydroxy-4-phenylbutyric acid
Boc-protected amino acid intermediate
N-Boc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
Boc-protected amino acid intermediate
Boc-(2RS,3S)-AHPA
Pharmaceutical intermediate for peptide synthesis
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
(2R,3R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid
BHTRKISIDQZUQX-VXGBXAGGSA-N
CC(C)(C)OC(=O)N[C@H](CC1=CC=CC=C1)[C@H](C(=O)O)O