N-Benzylglycine hydrochloride is a research compound used in peptide synthesis. It is the hydrochloride salt form of N-benzylglycine, featuring both an amine and a carboxylic acid group.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 7689-50-1
3-Amino-3-(1-methyl-1H-pyrrol-2-yl)propanoic acid
research compound for peptide synthesis
(R)-alpha-Propargylalanine
research compound for peptide synthesis
4-(Diethylamino)benzoic acid
research compound for peptide synthesis
Methyl 1-amino-1-cyclopentanecarboxylate, HCl
research compound for peptide synthesis
2-Fluoro-6-nitrotoluene
research compound
3-Cyano-4,6-dimethyl-2-hydroxypyridine
research compound
2,3,5,6-Tetrafluorophenol
research compound
Vinyl benzoate
human metabolite research compound
2-(benzylamino)acetic acid;hydrochloride
BUZJPENZWLUHJD-UHFFFAOYSA-N
C1=CC=C(C=C1)CNCC(=O)O.Cl