6-chloro-5-nitropyridine-3-carboxylic acid is a chemical compound used primarily as a research reagent. It features a pyridine ring substituted with chloro, nitro, and carboxylic acid functional groups, contributing to its moderate lipophilicity and polar surface area.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 7477-10-3
7-Chloroisatin
Chemical research intermediate
ATP dimagnesium salt
nucleotide research reagent
Tributyl(vinyl)tin
Stille coupling reagent for vinyl group transfer
2-AMINO-5-BROMO-3-FLUOROPYRIDINE
research compound
6-chloro-5-nitropyridine-3-carboxylic acid
HCRHNMXCDNACMH-UHFFFAOYSA-N
C1=C(C=NC(=C1[N+](=O)[O-])Cl)C(=O)O