Quinoline-2-boronic acid is a boronic acid derivative of quinoline used primarily as a research reagent. Its structure features an aromatic heterocyclic ring system with a boronic acid functional group, making it a versatile building block in organic synthesis.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 745784-12-7
Ethyl cyclopropylideneacetate
research compound
Diethylene Glycol Bis(p-toluenesulfonate)
research compound for crystallography
1-(2-azidoethoxy)-2-(2-methoxyethoxy)ethane
PEG linker with azide group
(S)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID
Research compound
quinolin-2-ylboronic acid
DWHCQRBWSBKHMI-UHFFFAOYSA-N
B(C1=NC2=CC=CC=C2C=C1)(O)O