2-amino-2-(3-chlorophenyl)acetic acid is a chemical compound used as a pharmaceutical intermediate. It features an amino acid backbone, an aromatic ring, and a chlorine substituent, and is utilized in the synthesis of peptide-based compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 7292-71-9
(3R)-1-[(tert-butoxy)carbonyl]pyrrolidine-3-carboxylic acid
pharmaceutical intermediate for synthesis
4,6-dichloronicotinic acid
Pharmaceutical intermediate for synthesis
2-Fluoro-5-nitrobenzoic acid
Pharmaceutical intermediate for synthesis
2-Amino-5-methylthiazole
Pharmaceutical intermediate
2-amino-2-(3-chlorophenyl)acetic acid
MGOUENCSVMAGSE-UHFFFAOYSA-N
C1=CC(=CC(=C1)Cl)C(C(=O)O)N