This compound is an orange azo pigment used primarily in the plastics industry. It features a complex heterocyclic structure combining benzimidazole and pyrimidinetrione moieties, contributing to its colorant properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 72102-84-2
Methylene Blue trihydrate
Bacteriological stain and dye
1-(2,5-dichloro-4-sulfophenyl)-5-pyrazolone-3-carboxylic acid
Dye intermediate
3,6-Bis(diethylamino)-9-(2-(methoxycarbonyl)phenyl)xanthylium tetrachlorozincate
Fluorescent solvent dye
Reactive Blue 81
Reactive dye for textile coloration
5-[(6-methyl-2-oxo-1,3-dihydrobenzimidazol-5-yl)diazenyl]-1,3-diazinane-2,4,6-trione
RITYHZCLJGBCAJ-UHFFFAOYSA-N
CC1=CC2=C(C=C1N=NC3C(=O)NC(=O)NC3=O)NC(=O)N2