This compound is a fluorinated beta-diketone used as a pharmaceutical intermediate in chemical synthesis. Its structure features an aromatic ring and multiple fluorine atoms, contributing to its reactivity and physical properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 720-94-5
Adenosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt
nucleotide derivative for biochemical research
4-Amino-5-chloro-2-methoxybenzoic acid
Pharmaceutical intermediate for APIs
5-methyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid hydrochloride
Edoxaban intermediate
(4S)-4-{[(tert-butoxy)carbonyl]amino}-5-methoxy-5-oxopentanoic acid
pharmaceutical intermediate for peptide synthesis
4,4,4-trifluoro-1-(4-methylphenyl)butane-1,3-dione
WRZMHTIRFOFFPY-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)F