This compound is an Fmoc-protected amino acid reagent used in solid-phase peptide synthesis. It features a fluorenylmethyloxycarbonyl (Fmoc) protecting group and tert-butyl ether side-chain protection, making it suitable for the stepwise assembly of peptides.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 71989-35-0
(2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid
Peptide building block
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-phenylpropanoic acid
Fmoc-protected amino acid reagent
6-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanoic acid
Fmoc-protected amino acid reagent
METHYL (2S,3R)-2-AMINO-3-(TERT-BUTOXY)BUTANOATE HYDROCHLORIDE
protected amino acid building block
(2R)-6-oxopiperidine-2-carboxylic acid
research compound
DdATP trisodium
Nucleotide analog research reagent
6-[5-(2-OXO-HEXAHYDRO-THIENO[3,4-D]IMIDAZOL-4-YL)-PENTANOYLAMINO]-HEXANOIC ACID
biotinylation reagent for protein labeling
(2R,3S)-3-(tert-butoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
Peptide synthesis building block
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid
LZOLWEQBVPVDPR-UHFFFAOYSA-N
CC(C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C