Fmoc-L-asparagine is an Fmoc-protected amino acid derivative used as a building block in solid-phase peptide synthesis. Its structure includes an amide side chain and a fluorenylmethoxycarbonyl protecting group, making it suitable for sequential assembly of peptides.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 71989-16-7
Fmoc-L-aspartic acid
research compound for peptide synthesis
N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-glutamine
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
Fmoc-L-Propargylglycine
Fmoc-protected amino acid for peptide synthesis
Fmoc-Ala-OH H2O
Fmoc-protected amino acid for peptide synthesis
Fmoc-Gly-OH
Fmoc-protected amino acid for peptide synthesis
Fmoc-L-glutamic acid 5-tert-butyl ester
Protected amino acid for peptide synthesis
N6-(tert-Butoxycarbonyl)-N2-((9H-fluoren-9-ylmethoxy)carbonyl)-L-lysine
Protected lysine derivative for peptide synthesis
(2S)-4-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid
YUGBZNJSGOBFOV-INIZCTEOSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)N)C(=O)O