Benzyl-d5 Bromide is a deuterium-labeled synthetic reagent, specifically This compound, used in chemical synthesis. Its primary significance lies in its role as a deuterated building block for introducing a benzyl group with five deuterium atoms, enabling mechanistic studies or isotopic labeling in research applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 71258-22-5
Copper(II) tosylate
Catalyst for organic synthesis
Diphenyl(4-(phenylthio)phenyl)sulfonium hexafluoroantimonate
Photoinitiator for cationic polymerization
2-Phenylbenzimidazole
sunscreen agent intermediate
Didecyldimethylammoniumchlorid
Disinfectant and biocide
BENZYL BROMIDE
Organic synthesis intermediate for benzyl protecting group
Benzyl bromide-d7
deuterated research standard
1-(bromomethyl)-2,3,4,5,6-pentadeuteriobenzene
AGEZXYOZHKGVCM-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])CBr)[2H])[2H]