Succinylcholine chloride is a quaternary ammonium compound used as a muscle relaxant active pharmaceutical ingredient. It acts as a depolarizing neuromuscular blocker and is typically employed during surgical procedures to facilitate endotracheal intubation and provide skeletal muscle relaxation.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 71-27-2
Dantrolene sodium hemiheptahydrate
muscle relaxant active pharmaceutical ingredient
Medroxyprogesteronacetat
hormonal progestin medication
Digitoxin
cardiac glycoside pharmaceutical ingredient
Natriumthiopental
intravenous anaesthetic
Isopropamide Iodide
anticholinergic active pharmaceutical ingredient
trimethyl-[2-[4-oxo-4-[2-(trimethylazaniumyl)ethoxy]butanoyl]oxyethyl]azanium dichloride
YOEWQQVKRJEPAE-UHFFFAOYSA-L
C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C.[Cl-].[Cl-]