This compound is a deuterium-labeled form of 4-aminobutanoic acid, specifically hexadeuterated at the carbon positions. It is primarily used as a stable isotope labeled analytical standard in research and laboratory settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 70607-85-1
Epsilon-Aminocaproic Acid-d10 Hydrochloride
research reagent for pharmacokinetic studies
3-((E)-((2-nitrophenyl)methylidene)amino)(2H4)-1,3-oxazolidin-2-one
stable isotope labeled analytical standard
Deschloroketamine
research compound
(S)-benzyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
3,3-dimethylbutanoyl chloride
research compound
1,3,5-tribromoadamantane
reference standard for impurity analysis
Γ-Aminobuttersäure
active pharmaceutical ingredient
4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid
BTCSSZJGUNDROE-NMFSSPJFSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])N