Tris(3,5-dimethylphenyl)phosphine is an organophosphorus compound featuring a phosphorus atom bonded to three 3,5-dimethylphenyl groups. It is structurally characterized by three aromatic rings and is of interest in coordination chemistry and materials research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 69227-47-0
tris(3,5-dimethylphenyl)phosphane
XRALRSQLQXKXKP-UHFFFAOYSA-N
CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=CC(=C3)C)C)C