3,4'-Dichlorodiphenyl ether is a chemical compound primarily used as a pharmaceutical intermediate in research and manufacturing. It features an ether linkage connecting two aromatic rings, each bearing a chlorine substituent, and is characterized by low polarity and a single hydrogen bond acceptor site.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 6842-62-2
Methyl 3-hydroxyadamantane-1-carboxylate
Pharmaceutical intermediate
3H-Indol-3-one, 1-acetyl-6-fluoro-1,2-dihydro-
pharmaceutical intermediate
Diethyl bromomalonate
Pharmaceutical intermediate
3-aminocyclohexanol
pharmaceutical intermediate
1-chloro-3-(4-chlorophenoxy)benzene
HPRGYUWRGCTBAV-UHFFFAOYSA-N
C1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)Cl