This compound is a beta-amino acid derivative featuring a 4-methylphenyl substituent. It serves as a pharmaceutical intermediate primarily utilized in the synthesis of peptide-based compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 68208-18-4
Thiocyanic acid, 2-amino-5-nitrophenyl ester
Pharmaceutical intermediate synthesis
(1S,2S)-2-aminocyclopentan-1-ol hydrochloride
pharmaceutical intermediate
(1R,2R)-2-aminocyclopentan-1-ol hydrochloride
Pharmaceutical intermediate
4-ethylcyclohexanecarboxylic acid
pharmaceutical intermediate
3-amino-3-(4-methylphenyl)propanoic acid
XPDAKEOBPKFUAH-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(CC(=O)O)N