1-(Benzyloxy)-4-bromobenzene is a brominated aromatic ether compound commonly used as a research reagent. Its structure features a bromine atom and a benzyloxy group attached to a benzene ring, making it useful in organic synthesis and materials research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 6793-92-6
(-)-Dihydroaflatoxin D2
pharmaceutical reference standard
N-(2-Amino-4-chlorophenyl)anthranilic acid
research compound
Tetraethylammonium iodide
Quaternary ammonium research reagent
1H-Imidazole, monohydriodide
Research reagent
1-bromo-4-phenylmethoxybenzene
OUQSGILAXUXMGI-UHFFFAOYSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)Br