Ethyl Pyruvate-3,3,3-d3 is a deuterated research compound labeled with three deuterium atoms at the methyl group. It is primarily used as a stable isotope internal standard in analytical chemistry and metabolic studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 66966-38-9
2-PYRROLIDINONE-3,3,4,4,5,5-D6
Deuterated research compound
2-BROMOPYRIDINE-D4
Deuterated research compound
4-Bromobenzoic-d4 Acid
Deuterated research compound
2-Hydroxy Estrone-d4
Deuterated research compound
(9H-Fluoren-9-yl)methyl 2-(aminomethyl)piperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
3-Aminomethyl-1-N-Fmoc-piperidine hydrochloride
Research reagent for peptide synthesis
4-(1-(tert-butoxycarbonyl)-1H-pyrrol-2-yl)benzoic acid
research compound
4,6-dibromodibenzothiophene
research compound for binuclear platinum complexes
ethyl 3,3,3-trideuterio-2-oxopropanoate
XXRCUYVCPSWGCC-BMSJAHLVSA-N
[2H]C([2H])([2H])C(=O)C(=O)OCC