2,3,5,6-Tetrafluoroterephthalic acid is a fluorinated aromatic dicarboxylic acid used as an industrial chemical intermediate. Its structure features a benzene ring substituted with four fluorine atoms and two carboxylic acid groups, making it a building block for specialty polymers and other advanced materials.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 652-36-8
Pentafluorobenzoic acid
Synthetic polymer MALDI matrix compound
Tetrafluoro-4-hydroxybenzoic acid
Organic synthesis intermediate
4-(trans-4-n-Propylcyclohexyl)benzoic acid
Liquid crystal intermediate
2,6-Dimethylhydroquinone
hydroquinone derivative intermediate
4-Nitro-2-(trifluoromethyl)anisole
chemical intermediate for synthesis
1,8-DIMETHYL-9H-CARBAZOLE
Electronic chemical intermediate
2,3,5,6-tetrafluoroterephthalic acid
WFNRNCNCXRGUKN-UHFFFAOYSA-N
C1(=C(C(=C(C(=C1F)F)C(=O)O)F)F)C(=O)O