Testosterone sulfate is a steroid sulfate derivative of testosterone, featuring a sulfoxy group at the 17-position. It is recognized as a naturally occurring human urinary metabolite and is utilized in research related to metabolic studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 651-45-6
4-Hydroxycyclohexanecarboxylic acid
human urinary metabolite research
Glycine, L-cysteinyl-L-asparaginylglycyl-L-arginyl-L-cysteinyl-
research compound
2-Bromo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
cross-coupling reagent for synthesis
H-Gly-Arg-AMC
fluorogenic enzyme substrate for peptidase assay
6-bromoquinoline-2-carboxylic acid
research compound
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] hydrogen sulfate
WAQBISPOEAOCOG-DYKIIFRCSA-N
C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OS(=O)(=O)O)CCC4=CC(=O)CC[C@]34C