2-Fluorobenzoic Acid-d4 is a deuterated analytical reference standard, specifically the This compound isotopologue. This compound is primarily used in research and laboratory settings to enable precise quantification and tracing in analytical chemistry applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 646502-89-8
Dimetridazole D3
stable isotope labeled reference standard
2-Bromo-4,5-difluorobenzonitrile
Research compound
2-Bromo-4,5-difluorobenzoic acid
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
2-FLUOROBENZOIC ACID
pharmaceutical intermediate
Sodium 2-fluorobenzoate
research compound
2,3,4,5-tetradeuterio-6-fluorobenzoic acid
NSTREUWFTAOOKS-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1[2H])C(=O)O)F)[2H])[2H]