Tetrapropylammonium iodide is a quaternary ammonium salt reagent commonly used in research. It serves as a source of tetrapropylammonium cations for various chemical applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 631-40-3
Tetrapropylammonium bromide
Phase transfer catalyst and research reagent
Tetrapropylammonium hydroxide
Structure-directing agent for zeolite synthesis
Tetraethylammonium fluoride trihydrate
phase transfer catalyst
2,3-Dihydroxy-N~1~,N~1~,N~4~,N~4~-tetramethylbutanediamide
research chemical
2-Chloroisonicotinic acid
research compound
(4-ethylphenyl)boronic acid
research compound for boronic acid chemistry
tetrapropylazanium iodide
GKXDJYKZFZVASJ-UHFFFAOYSA-M
CCC[N+](CCC)(CCC)CCC.[I-]