(3-Chlorophenyl)(phenyl)methanol is a research compound consisting of a benzhydrol structure bearing a chlorine substituent on one aromatic ring. It is commonly used as a laboratory reagent in chemical and pharmaceutical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 63012-03-3
1,7-DICHLORO-4-METHOXYISOQUINOLINE
research compound
(2E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid
research compound
4-Chloro-2-iodoaniline
research compound
Cyclopentylboronic acid
synthetic intermediate for organoboron chemistry
(3-chlorophenyl)-phenylmethanol
DDCJHFYXAPQYLA-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)O