This compound is an active pharmaceutical ingredient characterized as a derivative of piperazine and hydroxyphenylacetic acid. It features a complex molecular structure with multiple amide groups and an aromatic ring, reflecting its role in pharmaceutical manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 62893-24-7
(R)-2-(4-Ethyl-2,3-dioxopiperazine-1-carboxamido)-2-phenylacetic acid
intermediate for cephalosporin and beta-lactam antibiotics
Aspirin DL-lysine
active pharmaceutical ingredient
Primaquine diphosphate
antimalarial active pharmaceutical ingredient
Sulfanilamide
sulfonamide antibacterial drug
Colfosceril palmitate
pulmonary surfactant drug
(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid
IPARGUVYMOMVNU-LLVKDONJSA-N
CCN1CCN(C(=O)C1=O)C(=O)N[C@H](C2=CC=C(C=C2)O)C(=O)O