2,3-Dibromo-3-phenylpropionic acid is a research compound that contains a carboxylic acid group, an aromatic ring, and two halogen atoms. It is primarily used in laboratory research settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 6286-30-2
Alpha-D-Glucopyranose, 1-thio-, pentaacetate
synthetic carbohydrate reagent
2-Chloro-3-fluoropyridine-4-carboxylic acid
Research compound
2,5-Dimethoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
2-Hydroxyoctadecanoic acid
research compound
2,3-dibromo-3-phenylpropanoic acid
FXJWTHBNVZNQQP-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C(C(=O)O)Br)Br