2,2,2-Trifluoroethyl trifluoromethanesulfonate is a fluorinated chemical compound used primarily as a pharmaceutical intermediate. Its significance lies in its role in the synthesis of drug compounds, particularly those requiring trifluoroethyl group incorporation.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 6226-25-1
Propyltriphenylphosphonium bromide
pharmaceutical intermediate
Cyclopropanecarboxamide
pharmaceutical intermediate for prasugrel
((2E,4E)-3-Methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dien-1-yl)triphenylphosphonium bromide
intermediate for acitretin synthesis
4-Aminobenzyl alcohol
pharmaceutical intermediate
2,2,2-trifluoroethyl trifluoromethanesulfonate
RTMMSCJWQYWMNK-UHFFFAOYSA-N
C(C(F)(F)F)OS(=O)(=O)C(F)(F)F