4-Nitrobenzoesäure
4-Nitrobenzoic acid is a pale yellow organic solid used as an intermediate in the production of pharmaceuticals and dyes. It serves as a precursor to 4-nitrobenzoyl chloride, which is further utilized in the synthesis of compounds such as the anesthetic procaine and folic acid.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 62-23-7
4-CHLOROBENZOTRICHLORIDE
Intermediate for pharmaceuticals and dyes
3-Chlorobenzyl chloride
synthetic intermediate for pharmaceuticals
N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid
pharmaceutical intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid
Impurity standard for ubenimex
4-Nitrobenzoic Acid-d4
isotope labeled research compound
4-nitrobenzoic acid
OTLNPYWUJOZPPA-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)[N+](=O)[O-]