3,4-Dihydroxyphenylacetic Acid-d5 is a deuterium-labeled analog of 3,4-dihydroxyphenylacetic acid, used as an isotopically labeled research reference standard. It is characterized by five deuterium atoms incorporated at specific positions on the aromatic ring and the acetic acid side chain.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 60696-39-1
Dodecanoic-d23 acid
isotopically labeled research reference standard
Monoethyl Phthalate-d4
isotopically labeled research reference standard
Ethyldiphenylphosphine
organophosphine ligand for coordination chemistry
2-Nitro-1-naphthol
research compound
2,4-dichloroquinazoline
research compound
2-chloro-3,4-dihydroquinazolin-4-one
research compound
3,4-Dihydroxyphenylacetic acid
research compound for dopamine metabolism
2,2-dideuterio-2-(2,3,6-trideuterio-4,5-dihydroxyphenyl)acetic acid
CFFZDZCDUFSOFZ-QUWGTZMWSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])C(=O)O)[2H])O)O)[2H]
—