2-Amino-3-nitrobenzoic acid is a crystalline research compound characterized by an aromatic ring with both amino and nitro substituents adjacent to a carboxylic acid group. It is primarily of interest in structural chemistry and crystallographic studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 606-18-8
1,3-Indanedione
chemical intermediate for organic synthesis
Dihydronicotinamide-adenine dinucleotide, disodium salt
biochemical research reagent
13-Azido-2,5,8,11-tetraoxatridecane
PEG-based azide reagent
Dimethylpropanedioic acid dimethyl ester
research compound
2-amino-3-nitrobenzoic acid
JJPIVRWTAGQTPQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])N)C(=O)O