3-Nitrophthalic acid is a research reagent used primarily in crystallographic studies. It is characterized by the formation of O—H···O and C—H···O hydrogen bond motifs, which generate sheet-like structures in the solid state.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 603-11-2
2-Acetyl-6-nitrobenzoic acid
Pharmaceutical intermediate
Methyl 2,3-dichloroisonicotinate
research compound
2-Chloro-5-methyl-4-nitropyridine N-oxide
research compound
Alpha-Naphthoflavone
research compound
Methyl 1-amino-1-cyclopentanecarboxylate, HCl
research compound for peptide synthesis
3-nitrophthalic acid
KFIRODWJCYBBHY-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)O)C(=O)O