Triphenylessigsäure
Triphenylacetic acid is a research chemical consisting of a carboxylic acid group attached to a central carbon bearing three phenyl rings. It is commonly used as a laboratory reagent in organic synthesis and chemical research.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 595-91-5
2-Butanone, 3-chloro-3-methyl-
chemical synthesis intermediate
D-Alanine tert-butyl ester hydrochloride
research compound
2-Azidoadenosine
research intermediate for adenosine analogs
Naphtholphthalein
pH indicator
Rhodium(II) 2,2,2-triphenylacetate
research compound for catalysis
2,2,2-triphenylacetic acid
DCYGAPKNVCQNOE-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)O