Sulfone, p-chlorobenzyl methyl is a chemical compound with the structure of a sulfone bearing a p-chlorobenzyl group and a methyl group. It is identified by the canonical SMILES CS(=O)(=O)Cc1ccc(Cl)cc1 and has a molecular weight of 204.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 5925-80-4
1-chloro-4-(methylsulfonylmethyl)benzene
NLAHSDOLKYATFI-UHFFFAOYSA-N
CS(=O)(=O)CC1=CC=C(C=C1)Cl