This compound is a sulfonium salt used as a cationic photoinitiator, typically supplied as the hexafluorophosphate salt. It is designed to initiate cationic polymerization upon exposure to ultraviolet light, making it significant in UV-curable coatings and inks.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 591773-92-1
Triphenylsulfonium hexafluorophosphate
Cationic photoinitiator
1-HEXENE
Chemical intermediate and comonomer
2-Bromoethyl ethyl ether
chemical intermediate and insecticide precursor
1-Hepten
Organic synthesis intermediate
3-Hexadecanol
secondary fatty alcohol
10-(4-phenylphenyl)-2-propan-2-ylthioxanthen-10-ium-9-one hexafluorophosphate
UHKYZKDZFIFLBK-UHFFFAOYSA-N
CC(C)C1=CC2=C(C=C1)[S+](C3=CC=CC=C3C2=O)C4=CC=C(C=C4)C5=CC=CC=C5.F[P-](F)(F)(F)(F)F