Methyl olivetolate is a chemical compound used as a pharmaceutical intermediate. It features a pentyl-substituted aromatic ring with hydroxyl groups and an ester functional group, contributing to its role in chemical synthesis for pharmaceutical manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 58016-28-7
Ethyl 2,4-dihydroxy-6-pentylbenzoate
Lisdexamfetamine intermediate
6-Amino-5-ethyl-5-phenyl-2,4(3H,5H)-pyrimidinedione
Pharmaceutical impurity reference standard
2-Naphthylacetic acid
pharmaceutical intermediate
Tert-Butyl 1-amino-3,6,9,12-tetraoxapentadecan-15-oate
Polyethylene glycol linker for bioconjugation
1-(4-(3-Chloropropoxy)-3-methoxyphenyl)ethanone
Iloperidone intermediate
methyl 2,4-dihydroxy-6-pentylbenzoate
RQGAOBDPFOADCM-UHFFFAOYSA-N
CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC