4-Chloro-2-methoxybenzoic acid is a chemical compound used primarily as a pharmaceutical intermediate. It is a structural building block in the synthesis of various active pharmaceutical ingredients, including the investigational aurora A kinase inhibitor alisertib.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 57479-70-6
5-Chloro-2-methoxybenzoic acid
Pharmaceutical intermediate for drug synthesis
Methyl (2-chlorophenyl)acetate
Pharmaceutical intermediate for drug synthesis
2,4,5-Trichloropyrimidine
pharmaceutical synthesis intermediate
4-CHLORO-5-NITRO-1H-IMIDAZOLE
pharmaceutical intermediate
N-(tert-Butoxycarbonyl)-N-methyl-2-aminoethanol
Boc-protected amino alcohol intermediate
4-chloro-2-methoxybenzoic acid
UFEYMXHWIHFRBX-UHFFFAOYSA-N
COC1=C(C=CC(=C1)Cl)C(=O)O