Pentaerythritol tris(3-(1-aziridinyl)propionate) is an industrial chemical used primarily as a hardener. Its structure incorporates multiple aziridine and ester groups, providing crosslinking functionality in various material applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 57116-45-7
3,4'-Dibromobiphenyl
flame retardant additive
Duralink HTS
Stabilizing agent
Basisches Zirconium(IV)-carbonat
Paint and coating additive
Dilithium tetrachloromanganate(2-)
Industrial chemical compound
[2,2-bis[3-(aziridin-1-yl)propanoyloxymethyl]-3-hydroxypropyl] 3-(aziridin-1-yl)propanoate
KAPCRJOPWXUMSQ-UHFFFAOYSA-N
C1CN1CCC(=O)OCC(CO)(COC(=O)CCN2CC2)COC(=O)CCN3CC3