Pyridoxine tris-hexyldecanoate is a highly lipophilic ester derivative of pyridoxine (vitamin B6). Its structure consists of a pyridine ring with three long-chain branched ester groups, making it a large, flexible molecule with high molecular weight and extreme hydrophobicity.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 564478-51-9
[5-(2-hexyldecanoyloxy)-4-(2-hexyldecanoyloxymethyl)-6-methyl-3-pyridinyl]methyl 2-hexyldecanoate
GQJPGCPNWFZCPD-UHFFFAOYSA-N
CCCCCCCCC(CCCCCC)C(=O)OCC1=CN=C(C(=C1COC(=O)C(CCCCCC)CCCCCCCC)OC(=O)C(CCCCCC)CCCCCCCC)C